The Cyclizine hydrochloride, with the CAS registry number 303-25-3, is also known as 1-(Diphenylmethyl)-4-methylpiperazine monohydrochloride. Its EINECS registry number is 206-136-9. This chemical's molecular formula is C₁₈H₂₃ClN₂ and molecular weight is 302.84162. Its IUPAC name is called 1-benzhydryl-4-methylpiperazine hydrochloride. This chemical's classification codes are Anti-emetic; Drug / Therapeutic Agent; Reproductive Effect.

Physical properties of Cyclizine hydrochloride: (1)ACD/LogP: 2.41; (2)ACD/LogD (pH 5.5): 0.12; (3)ACD/LogD (pH 7.4): 1.82; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 10.29; (6)ACD/KOC (pH 5.5): 2.5; (7)ACD/KOC (pH 7.4): 125.76; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 3; (10)Flash Point: 159.1 °C; (11)Enthalpy of Vaporization: 60.98 kJ/mol; (12)Boiling Point: 363.7 °C at 760 mmHg; (13)Vapour Pressure: 1.77E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
(2)InChI: InChI=1S/C18H22N2.ClH/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18H,12-15H2,1H3;1H
(3)InChIKey: UKPBEPCQTDRZSE-UHFFFAOYSA-N

The toxicity data is as follows: