The CAS register number of Cyclopentanol, 2-amino- is 89381-13-5. It also can be called as Cyclopentanol, trans-2-amino- and the systematic name about this chemical is 2-aminocyclopentanol. The molecular formula about this chemical is C₅H₁₁NO and the molecular weight is 101.15. It belongs to the following product categories, such as Variousamine; Pharmacetical and so on.

Physical properties about Cyclopentanol, 2-amino- are: (1)ACD/LogP: -0.73; (2)ACD/LogD (pH 5.5): -3.82; (3)ACD/LogD (pH 7.4): -3.36; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 2; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 2; (11)Polar Surface Area: 12.47Ų; (12)Index of Refraction: 1.516; (13)Molar Refractivity: 28.2 cm³; (14)Molar Volume: 93.2 cm³; (15)Polarizability: 11.18x10^-24cm³; (16)Surface Tension: 41.5 dyne/cm; (17)Enthalpy of Vaporization: 48.39 kJ/mol; (18)Boiling Point: 179.4 °C at 760 mmHg; (19)Vapour Pressure: 0.28 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OC1CCCC1N
(2)InChI: InChI=1/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2
(3)InChIKey: JFFOUICIRBXFRC-UHFFFAOYAF
(4)Std. InChI: InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2
(5)Std. InChIKey: JFFOUICIRBXFRC-UHFFFAOYSA-N