| Chemistry name: | glyceryl diacetate |
| M Formula: | CH2O(OCCH3)CH2OCH2O(OCCH3) |
| Properties: | |
| Hygroscopic liquid. A mixture of isomers. D 1.18, bp approximately 259C, refr index 1.44. Miscible with water, benzene, and alcohol. The commercial mixture gels approximately−30C. Combustible. | |
| Derivation: | |
| Heating one mole of glycerol with two moles of glacial acetic acid. | |
| Grade: | |
| Technical. | |
| Use: | |
| Plasticizer and softening agent, solvent for cellulose derivatives, “Glyptal” resins, shellac. | |