The CAS register number of Dimethyl 2-(2-methoxyphenoxy)malonate is 150726-89-9. It also can be called as 2-(2-Methoxyphenoxy)malonic acid dimethyl ester and the systematic name about this chemical is dimethyl (2-methoxyphenoxy)propanedioate. The molecular formula about this chemical is C₁₂H₁₄O₆ and the molecular weight is 254.24. It belongs to the following product categories, such as Aromatics Compounds; Aromatics and so on.

Physical properties about Dimethyl 2-(2-methoxyphenoxy)malonate are: (1)ACD/LogP: 2.05; (2)ACD/LogD (pH 5.5): 1; (3)ACD/LogD (pH 7.4): 1; (4)ACD/BCF (pH 5.5): 3; (5)ACD/BCF (pH 7.4): 3; (6)ACD/KOC (pH 5.5): 73; (7)ACD/KOC (pH 7.4): 73; (8)#H bond acceptors: 6; (9)#Freely Rotating Bonds: 7; (10)Polar Surface Area: 71.06Ų; (11)Index of Refraction: 1.497; (12)Molar Refractivity: 61.65 cm³; (13)Molar Volume: 210.806 cm³; (14)Polarizability: 24.44x10^-24cm³; (15)Surface Tension: 38.939 dyne/cm; (16)Enthalpy of Vaporization: 56.214 kJ/mol; (17)Boiling Point: 320.47 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: COC(=O)C(Oc1ccccc1OC)C(=O)OC
(2)InChI: InChI=1/C12H14O6/c1-15-8-6-4-5-7-9(8)18-10(11(13)16-2)12(14)17-3/h4-7,10H,1-3H3
(3)InChIKey: SBUXKADXTZOBJV-UHFFFAOYAW
(4)Std. InChI: InChI=1S/C12H14O6/c1-15-8-6-4-5-7-9(8)18-10(11(13)16-2)12(14)17-3/h4-7,10H,1-3H3
(5)Std. InChIKey: SBUXKADXTZOBJV-UHFFFAOYSA-N