The CAS register number of Fmoc-L-Propargylglycine is 198561-07-8. It also can be called as (S)-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)pent-4-ynoic acid and the IUPAC name about this chemical is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. The molecular formula about this chemical is C₂₀H₁₇NO₄ and the molecular weight is 335.35. It belongs to the following product categories, such as Amino Acids; Unusual amino acids; Amino Acid Derivatives and so on.

Physical properties about Fmoc-L-Propargylglycine are: (1)ACD/LogP: 4.19; (2)ACD/LogD (pH 5.5): 1.75; (3)ACD/LogD (pH 7.4): 0.54; (4)ACD/BCF (pH 5.5): 3.24; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 16.29; (7)ACD/KOC (pH 7.4): 1.01; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 6; (11)Polar Surface Area: 55.84Ų; (12)Index of Refraction: 1.618; (13)Molar Refractivity: 91 cm³; (14)Molar Volume: 259.5 cm³; (15)Polarizability: 36.07x10^-24cm³; (16)Surface Tension: 59.4 dyne/cm; (17)Enthalpy of Vaporization: 90.84 kJ/mol; (18)Boiling Point: 576.7 °C at 760 mmHg; (19)Vapour Pressure: 3.84E-14 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)[C@@H](NC(=O)OCC3c1ccccc1c2c3cccc2)CC#C
(2)InChI: InChI=1/C20H17NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h1,3-6,8-11,17-18H,7,12H2,(H,21,24)(H,22,23)/t18-/m0/s1
(3)InChIKey: DJGMNCKHNMRKFM-SFHVURJKBM
(4)Std. InChI: InChI=1S/C20H17NO4/c1-2-7-18(19(22)23)21-20(24)25-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h1,3-6,8-11,17-18H,7,12H2,(H,21,24)(H,22,23)/t18-/m0/s1
(5)Std. InChIKey: DJGMNCKHNMRKFM-SFHVURJKSA-N