This chemical is called Guanosine, 2'-deoxy-N-ethyl-, and it's also named as 2'-deoxy-N-ethylguanosine. With the molecular formula of C₁₂H₁₇N₅O₄, its molecular weight is 295.29. The CAS registry number of this chemical is 101803-03-6.

Other characteristics of the Guanosine, 2'-deoxy-N-ethyl- can be summarised as followings: (1)#H bond acceptors: 9; (2)#H bond donors: 4; (3)#Freely Rotating Bonds: 5; (4)Polar Surface Area: 121 Å²; (5)Index of Refraction: 1.778; (6)Molar Refractivity: 70.13 cm³; (7)Molar Volume: 167.4 cm³; (8)Polarizability: 27.8×10^-24cm³; (9)Surface Tension: 76.5 dyne/cm; (10)Density: 1.76 g/cm³.

You can still convert the following datas into molecular structure: 
1.SMILES: CCN\C3=N\c2c(ncn2[C@H]1C[C@H](O)[C@@H](CO)O1)C(=O)N3
2.InChI: InChI=1/C12H17N5O4/c1-2-13-12-15-10-9(11(20)16-12)14-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,2-4H2,1H3,(H2,13,15,16,20)/t6-,7+,8+/m0/s1
3.InChIKey: VOKQFDULHQUWAV-XLPZGREQBR