The Hydrocortisone sodium succinate, with the CAS registry number 125-04-2, is also known as 11beta,17alpha,21-Trihydroxy-4-pregnene-3,20-dione 21-hemisuccinate sodium salt. Its EINECS registry number is 204-725-5. This chemical's molecular formula is C₂₅H₃₃NaO₈ and molecular weight is 484.51449. Its IUPAC name is called sodium 4-[2-[(8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoate. This chemical which is used as a pharmaceutical intermediate should be stored at - 20 °C. This chemical's classification codes are Drug / Therapeutic Agent; Glucocorticoid; Human Data; Reproductive Effect.

Physical properties of Hydrocortisone sodium succinate are: (1)ACD/LogP: 2.13; (2)#H bond acceptors: 8; (3)#H bond donors: 3; (4)#Freely Rotating Bonds: 9; (5)Flash Point: 231.1 °C; (6)Enthalpy of Vaporization: 114.97 kJ/mol; (7)Boiling Point: 685.5 °C at 760 mmHg; (8)Vapour Pressure: 9.36E-22 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[O-]C(=O)CCC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@H]4[C@H]([C@@H](O)C[C@]12C)[C@@]3(/C(=C\C(=O)CC3)CC4)C
(2)InChI: InChI=1/C25H34O8.Na/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30;/h11,16-18,22,27,32H,3-10,12-13H2,1-2H3,(H,29,30);/q;+1/p-1/t16-,17-,18-,22+,23-,24-,25-;/m0./s1
(3)InChIKey: HHZQLQREDATOBM-HVZBPSDKBG

The toxicity data is as follows: