This chemical is called Imidazo[1,2-a]pyridine-5-carboxylic acid. With the molecular formula of C₈H₆N₂O₂, its molecular weight is 162.15. The CAS registry number of this chemical is 479028-72-3. Additionally, its product categories are Aminetertiary; Glycinescaffold.

Other characteristics of the Imidazo[1,2-a]pyridine-5-carboxylic acid can be summarised as followings: (1)ACD/LogP: 1.03; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/BCF (pH 7.4): 1; (5)ACD/KOC (pH 5.5): 1; (6)ACD/KOC (pH 7.4): 1; (7)#H bond acceptors: 4; (8)#H bond donors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 54.6 Å²; (11)Index of Refraction: 1.676; (12)Molar Refractivity: 43.02 cm³; (13)Molar Volume: 114.3 cm³; (14)Polarizability: 17.05×10^-24cm³; (15)Surface Tension: 60.5 dyne/cm; (16)Density: 1.41 g/cm³.

You can still convert the following datas into molecular structure:
1.SMILES: OC(=O)c1cccc2nccn12
2.InChI: InChI=1/C8H6N2O2/c11-8(12)6-2-1-3-7-9-4-5-10(6)7/h1-5H,(H,11,12)
3.InChIKey: IAXRYEXXAPLEGT-UHFFFAOYAI