The Iodonium, diphenyl-, (OC-6-11)-hexafluoroantimonate(1-) (1:1), with the CAS registry number 52754-92-4, is also known as Diphenyliodonium hexafluoroantimonate. This chemical's molecular formula is C₁₂H₁₀F₆ISb^-5 and molecular weight is 516.86. What's more, its IUPAC name is antimony; diphenyliodanium; hexafluoride.

Computational chemistry data of Iodonium, diphenyl-, (OC-6-11)-hexafluoroantimonate(1-) (1:1) are: (1)H-Bond Donor 0; (2)H-Bond Acceptor 6; (3)Rotatable Bond Count 2; (4)Exact Mass 515.876956; (5)MonoIsotopic Mass 515.876956; (6)Topological Polar Surface Area 0; (7)Heavy Atom Count 20; (8)Formal Charge -5; (9)Complexity 116; (10)Isotope Atom Count 0; (11)Defined Atom StereoCenter Count 0; (12)Undefined Atom StereoCenter Count 0; (13)Defined Bond StereoCenter Count 0; (14)Undefined Bond StereoCenter Count 0; (15)Covalently-Bonded Unit Count 8.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[F-].[F-].[F-].[F-].[F-].[F-].[Sb]
(2)InChI: InChI=1S/C12H10I.6FH.Sb/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;;;;/h1-10H;6*1H;/q+1;;;;;;;/p-6
(3)InChIKey: QRAUMBNMFLCOTA-UHFFFAOYSA-H