The L-Homocysteine, S-ethyl-, methyl ester, with the CAS registry number 6687-25-8, is also known as 1,4-Butanediol, 2,3-bis((3-hydroxyphenyl)methyl)-. This chemical's molecular formula is C₁₈H₂₂O₄ and molecular weight is 302.36488. Its IUPAC name is called 2,3-bis[(3-hydroxyphenyl)methyl]butane-1,4-diol. 

Physical properties of L-Homocysteine, S-ethyl-, methyl ester: (1)ACD/LogP: 1.58; (2)ACD/LogD (pH 5.5): 1.57; (3)ACD/LogD (pH 7.4): 1.57; (4)ACD/BCF (pH 5.5): 9.26; (5)ACD/BCF (pH 7.4): 9.22; (6)ACD/KOC (pH 5.5): 171.24; (7)ACD/KOC (pH 7.4): 170.36; (8)#H bond acceptors: 4; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 11; (11)Index of Refraction: 1.626; (12)Molar Refractivity: 85.57 cm³; (13)Molar Volume: 241.6 cm³; (14)Surface Tension: 60.3 dyne/cm; (15)Density: 1.251 g/cm³; (16)Flash Point: 262.5 °C; (17)Enthalpy of Vaporization: 87.97 kJ/mol; (18)Boiling Point: 554.9 °C at 760 mmHg; (19)Vapour Pressure: 3.79E-13 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Oc1cc(ccc1)CC(C(Cc2cccc(O)c2)CO)CO
(2)InChI: InChI=1/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2
(3)InChIKey: DWONJCNDULPHLV-UHFFFAOYAF