This chemical is called Methyl (2S)-2-amino-2-cyclopentyl-acetate hydrochloride, and its CAS registry number is 14328-62-2. With the molecular formula of C₈H₁₆ClNO₂, its molecular weight is 193.67. Additionally, its product category is Non-natural Amino Acids.

Other characteristics of the Methyl (2S)-2-amino-2-cyclopentyl-acetate hydrochloride can be summarised as followings: (1)ACD/LogP: 1.01; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.52 ; (4)#H bond acceptors: 3; (5)#H bond donors: 2; (6)#Freely Rotating Bonds: 4; (7)Polar Surface Area: 52.32 Å²; (8)Flash Point: 104.9 °C; (9)Enthalpy of Vaporization: 49.69 kJ/mol; (10)Boiling Point: 249.8 °C at 760 mmHg; (11)Vapour Pressure: 0.0178 mmHg at 25°C.

You can still convert the following datas into molecular structure:
1.SMILES: O=C(OC)[C@@H](N)C1CCCC1.Cl
2.InChI: InChI=1/C8H15NO2.ClH/c1-11-8(10)7(9)6-4-2-3-5-6;/h6-7H,2-5,9H2,1H3;1H/t7-;/m0./s1
3.InChIKey: OQEFEOSHQDCMLN-FJXQXJEOBA