The Pentane,1,5-dibromo-2,2,3,3,4,4-hexafluoro- has the CAS registry number 33619-78-2. This chemical's molecular formula is C₅H₄Br₂F₆ and molecular weight is 337.88. What's more, its systematic name is 1,5-Dibromo-2,2,3,3,4,4-hexafluoropentane.

Physical properties of Pentane,1,5-dibromo-2,2,3,3,4,4-hexafluoro- are: (1)ACD/LogP: 4.17; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.17; (4)ACD/LogD (pH 7.4): 4.17; (5)ACD/BCF (pH 5.5): 867.61; (6)ACD/BCF (pH 7.4): 867.61; (7)ACD/KOC (pH 5.5): 4414.2; (8)ACD/KOC (pH 7.4): 4414.2; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Index of Refraction: 1.403; (13)Molar Refractivity: 41.55 cm³; (14)Molar Volume: 170.2 cm³; (15)Polarizability: 16.47×10^-24 cm³; (16)Surface Tension: 24.2 dyne/cm; (17)Density: 1.984 g/cm³; (18)Flash Point: 66.6 °C; (19)Enthalpy of Vaporization: 40.53 kJ/mol; (20)Boiling Point: 186.4 °C at 760 mmHg; (21)Vapour Pressure: 0.911 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C(C(C(C(CBr)(F)F)(F)F)(F)F)Br
(2)InChI: InChI=1S/C5H4Br2F6/c6-1-3(8,9)5(12,13)4(10,11)2-7/h1-2H2
(3)InChIKey: QMSMXOXREPKYSH-UHFFFAOYSA-N