Chemical Property of Methyl glucosinolate
Edit
Chemical Property:
- Melting Point:198 °C (decomp)
- Boiling Point:°Cat760mmHg
- PKA:-2.94±0.18(Predicted)
- Flash Point:°C
- PSA：199.79000
- Density:g/cm3
- LogP:-1.24690
- XLogP3:-1.8
- Hydrogen Bond Donor Count:5
- Hydrogen Bond Acceptor Count:11
- Rotatable Bond Count:5
- Exact Mass:333.01882340
- Heavy Atom Count:20
- Complexity:447
- Purity/Quality:
-
99%, *data from raw suppliers
Safty Information:
- Pictogram(s):
- Hazard Codes:
- MSDS Files:
-
SDS file from LookChem
Useful:
- Canonical SMILES:CC(=NOS(=O)(=O)O)SC1C(C(C(C(O1)CO)O)O)O
- Isomeric SMILES:C/C(=N\OS(=O)(=O)O)/SC1C(C(C(C(O1)CO)O)O)O
-
Use Description
The compound {(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-2-(hydroxymethyl)-6-(C-methyl-N-sulfonatooxycarbonimidoyl)sulfanyl-oxane}, while a complex and specific chemical, finds limited applications primarily in the field of synthetic organic chemistry and potentially in medicinal chemistry. Its role revolves around its use as a reagent for the synthesis and modification of organic molecules, particularly those with potential pharmaceutical significance. The specific functional groups present in this compound, including the sulfonate and hydroxyl groups, make it valuable for introducing or altering chemical functionalities in target molecules, contributing to the development of novel drugs or drug intermediates. Additionally, it might be utilized in academic research for studying chemical reactions and the development of new synthetic methodologies. Its applications are niche and mainly within the realm of chemical synthesis and drug discovery, where it plays a pivotal role in advancing pharmaceutical research and organic chemistry.
