Chemical Property of Benzetimide
Chemical Property:
- Vapor Pressure:6.86E-12mmHg at 25°C
- Melting Point:156-159°
- Boiling Point:543.9°Cat760mmHg
- Flash Point:282.7°C
- PSA：49.41000
- Density:1.178g/cm3
- LogP:3.53990
- XLogP3:3.1
- Hydrogen Bond Donor Count:1
- Hydrogen Bond Acceptor Count:3
- Rotatable Bond Count:4
- Exact Mass:362.199428076
- Heavy Atom Count:27
- Complexity:529
- Purity/Quality:
-
99% *data from raw suppliers
1''-Benzyl-3-Phenyl-[3,4''-Bipiperidine]-2,6-Dione *data from reagent suppliers
Safty Information:
- Pictogram(s):
- Hazard Codes:
- MSDS Files:
-
SDS file from LookChem
Useful:
- Canonical SMILES:C1CN(CCC1C2(CCC(=O)NC2=O)C3=CC=CC=C3)CC4=CC=CC=C4
-
Use Description
3-(1-benzyl-4-piperidyl)-3-phenyl-piperidine-2,6-dione is a chemical compound with potential applications in various fields. In the field of pharmaceuticals and medicinal chemistry, it can serve as a key intermediate in the synthesis of organic molecules and pharmaceutical agents, potentially contributing to the development of new drugs targeting a range of medical conditions. Its role is pivotal in drug discovery and development, aiding in the creation of medications with specific therapeutic properties. Additionally, in the field of chemical research, 3-(1-benzyl-4-piperidyl)-3-phenyl-piperidine-2,6-dione can be employed as a reference compound for the study of piperidine derivatives and their reactivity, facilitating research in organic chemistry and chemical analysis. Furthermore, in the pharmaceutical industry, it may find applications as a chemical intermediate for the development of new drug compounds, potentially contributing to drug discovery and medicinal chemistry research. Its multifaceted utility underscores its significance in pharmaceuticals, chemical research, and scientific investigation, where it plays a crucial role in drug innovation, compound synthesis, and chemical analysis.
