The Pyrene, 1-azido-, with CAS registry number 36171-39-8, has the systematic name of 1-azidopyrene. Besides this, it is also called 1-Pyrenyl azide. Its molecular weight is 243.2628. And the chemical formula of this chemical is C₁₆H₉N₃.

Physical properties of Pyrene, 1-azido-: (1)ACD/LogP: 5.54; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.54; (4)ACD/LogD (pH 7.4): 5.54; (5)ACD/BCF (pH 5.5): 9591.21; (6)ACD/BCF (pH 7.4): 9591.21; (7)ACD/KOC (pH 5.5): 24649.88; (8)ACD/KOC (pH 7.4): 24649.88; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 12.36 Å².

You can still convert the following datas into molecular structure:
(1)SMILES: [N-]=[N+]=N/c4ccc2ccc1cccc3c1c2c4cc3
(2)InChI: InChI=1/C16H9N3/c17-19-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H
(3)InChIKey: BMNGOGRNWBJJKB-UHFFFAOYAV
(4)Std. InChI: InChI=1S/C16H9N3/c17-19-18-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H
(5)Std. InChIKey: BMNGOGRNWBJJKB-UHFFFAOYSA-N