The Pyridine,3-methyl-4-phenyl-, with the CAS registry number 2052-92-8, is also known as Pyridine, 5-methyl-4-phenyl-. This chemical's molecular formula is C₁₂H₁₁N and molecular weight is 169.22. Its systematic name is called 3-methyl-4-phenylpyridine.

Physical properties of Pyridine,3-methyl-4-phenyl-: (1)ACD/LogP: 3.05; (2)ACD/LogD (pH 5.5): 2.64; (3)ACD/LogD (pH 7.4): 3.04; (4)ACD/BCF (pH 5.5): 48.16; (5)ACD/BCF (pH 7.4): 120.13; (6)ACD/KOC (pH 5.5): 427.43; (7)ACD/KOC (pH 7.4): 1066.22; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.568; (11)Molar Refractivity: 53.76 cm³; (12)Molar Volume: 164.2 cm³; (13)Surface Tension: 39.7 dyne/cm; (14)Density: 1.03 g/cm³; (15)Flash Point: 109 °C; (16)Enthalpy of Vaporization: 48.52 kJ/mol; (17)Boiling Point: 267.6 °C at 760 mmHg; (18)Vapour Pressure: 0.0133 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n2ccc(c1ccccc1)c(c2)C
(2)InChI: InChI=1/C12H11N/c1-10-9-13-8-7-12(10)11-5-3-2-4-6-11/h2-9H,1H3
(3)InChIKey: RZUHSRAKAFYVFA-UHFFFAOYAM