The Pyritinol dihydrochloride, with the CAS registry number 10049-83-9, is also known as 3,3'-Dithiobis(methylene)bis(5-hydroxy-6-methyl-4-pyridinemethanol) dihydrochloride. Its EINECS registry number is 233-178-5. The molecular formula is C₁₆H₂₂Cl₂N₂O₄S₂ and molecular weight is 441.39. Its systematic name is called 5,5'-(disulfanediyldimethanediyl)bis[4-(hydroxymethyl)-2-methylpyridin-3-ol] dihydrochloride. And it belongs to the class of Drug / Therapeutic Agent. What's more, it can be used to prepare organic functional materials and medicine.

Physical properties of Pyritinol dihydrochloride: (1)ACD/LogP: 1.09; (2)ACD/LogD (pH 5.5): 0.33; (3)ACD/LogD (pH 7.4): 0.47; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 16.43; (7)ACD/KOC (pH 7.4): 22.39; (8)#H bond acceptors: 6; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 11; (11)Flash Point: 403 °C; (12)Enthalpy of Vaporization: 113.68 kJ/mol; (13)Boiling Point: 742.8 °C at 760 mmHg; (14)Vapour Pressure: 3.6E-23 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CC1=NC=C(C(=C1O)CO)CSSCC2=CN=C(C(=C2CO)O)C.Cl.Cl
(2)InChI: InChI=1S/C16H20N2O4S2.2ClH/c1-9-15(21)13(5-19)11(3-17-9)7-23-24-8-12-4-18-10(2)16(22)14(12)6-20;;/h3-4,19-22H,5-8H2,1-2H3;2*1H
(3)InChIKey: HRZWYHGGJOWGRI-UHFFFAOYSA-N

The toxicity data is as follows: