The Quinoline, 4-ethoxy-, with the CAS registry number 13720-91-7, is also known as 4-Ethoxy-quinoline. This chemical's molecular formula is C₁₁H₁₁NO and molecular weight is 173.21114. Its IUPAC name is called 4-ethoxyquinoline.

Physical properties of Quinoline, 4-ethoxy-: (1)ACD/LogP: 2.88; (2)ACD/LogD (pH 5.5): 1.98; (3)ACD/LogD (pH 7.4): 2.84; (4)ACD/BCF (pH 5.5): 11.31; (5)ACD/BCF (pH 7.4): 83.56; (6)ACD/KOC (pH 5.5): 109.22; (7)ACD/KOC (pH 7.4): 806.59; (8)#H bond acceptors: 2; (9)#Freely Rotating Bonds: 2; (10)Index of Refraction: 1.595; (11)Molar Refractivity: 53.49 cm³; (12)Molar Volume: 157.2 cm³; (13)Surface Tension: 42.5 dyne/cm; (14)Density: 1.101 g/cm³; (15)Flash Point: 96.2 °C; (16)Enthalpy of Vaporization: 48.04 kJ/mol; (17)Boiling Point: 262.8 °C at 760 mmHg; (18)Vapour Pressure: 0.0174 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCOC1=CC=NC2=CC=CC=C21
(2)InChI: InChI=1S/C11H11NO/c1-2-13-11-7-8-12-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3
(3)InChIKey: NBAWYUCPNKZTER-UHFFFAOYSA-N