The Quinoline, 6-methoxy-2-methyl-8-nitro-, with the CAS registry number 54232-06-3, is also known as 2-Methyl-6-methoxy-8-nitroquinoline. This chemical's molecular formula is C₁₁H₁₀N₂O₃ and molecular weight is 218.2087. What's more, its systematic name is called 6-Methoxy-2-methyl-8-nitroquinoline.

Physical properties about this chemical are: (1)ACD/LogP: 2.32; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 67.94 Å²; (7)Index of Refraction: 1.631; (8)Molar Refractivity: 60.23 cm³; (9)Molar Volume: 168.8 cm³; (10)Surface Tension: 52.6 dyne/cm; (11)Density: 1.292 g/cm³; (12)Flash Point: 179.4 °C; (13)Enthalpy of Vaporization: 59.59 kJ/mol; (14)Boiling Point: 373 °C at 760 mmHg; (15)Vapour Pressure: 1.98E-05 mmHg at 25 °C.

Uses of Quinoline, 6-methoxy-2-methyl-8-nitro-: it is used to produce other chemicals. For example, it is used to produce 6-Methoxy-2-methyl-[8]quinolylamine.

The reaction occurs with reagent Iron powder, Glacial acetic acid and solvent Ethanol. The reaction time is 3.5 hours. The yield is 94%.

You can still convert the following datas into molecular structure:
(1) SMILES: [O-][N+](=O)c1cc(OC)cc2ccc(nc12)C
(2) InChI: InChI=1/C11H10N2O3/c1-7-3-4-8-5-9(16-2)6-10(13(14)15)11(8)12-7/h3-6H,1-2H3
(3) InChIKey: XATLPIDKCYRSNH-UHFFFAOYAL