Products Categories
| CAS No.: | 1001645-58-4 |
|---|---|
| Name: | SRT1720 |
| Molecular Structure: | |
|
|
|
| Formula: | C25H23N7OS.HCl |
| Molecular Weight: | 506.02 |
| Synonyms: | SRT-1720; |
| Density: | 1.58 |
| PSA: | 115.69000 |
| LogP: | 4.80520 |
The SRT1720, with its CAS registry number 1001645-58-4, has the systematic name of N-[2-[3-(piperazin-1-ylmethyl)imidazo[2,1-b]thiazol-6-yl]phenyl]quinoxaline-2-carboxamide hydrochloride. And it has the molecular formula of C25H23N7OS.HCl and the molecular weight of 506.02. When store it, it should be kept in the dry and well-ventilated place with the temperature of -20 °C. When comes to its usage, it is often used as the selective activator of human SIRT1 versus the the closest sirtuin homologues, SIRT2 and SIRT3.
What's more, the following datas could be converted into the molecular structure:
(1)SMILES:c1ccc(c(c1)c2cn3c(csc3n2)CN4CCNCC4)NC(=O)c5cnc6ccccc6n5.Cl
(2)InChI:InChI=1/C25H23N7OS.ClH/c33-24(22-13-27-20-7-3-4-8-21(20)28-22)29-19-6-2-1-5-18(19)23-15-32-17(16-34-25(32)30-23)14-31-11-9-26-10-12-31;/h1-8,13,15-16,26H,9-12,14H2,(H,29,33);1H
(3)InChIKey:DTGRRMPPXCRRIM-UHFFFAOYAO
(4)Std. InChI:InChI=1S/C25H23N7OS.ClH/c33-24(22-13-27-20-7-3-4-8-21(20)28-22)29-19-6-2-1-5-18(19)23-15-32-17(16-34-25(32)30-23)14-31-11-9-26-10-12-31;/h1-8,13,15-16,26H,9-12,14H2,(H,29,33);1H
(5)Std. InChIKey:DTGRRMPPXCRRIM-UHFFFAOYSA-N