Products Categories
CAS No.: | 10101-21-0 |
---|---|
Name: | Strontium D-gluconate (1:2) |
Molecular Structure: | |
Formula: | C12H22O14Sr |
Molecular Weight: | 477.91 |
Synonyms: | Strontiumgluconate;$I2-Strontane; (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate; |
EINECS: | 233-249-0 |
Density: | 1.763g/cm3 |
Melting Point: | 131oC |
Boiling Point: | 673.6°C at 760 mmHg |
Flash Point: | 375.2°C |
PSA: | 282.56000 |
LogP: | -9.65560 |
What can I do for you?
Get Best Price
The Strontium D-gluconate (1:2), with the CAS registry number 10101-21-0, is also known as Strontiumgluconate. Its EINECS number is 233-249-0. This chemical's molecular formula is C12H22O14Sr and molecular weight is 477.91.
Physical properties of Strontium D-gluconate (1:2) are: (1)#H bond acceptors: 14; (2)#H bond donors: 12; (3)#Freely Rotating Bonds: 20; (4)Polar Surface Area: 282.56 Å2.
You can still convert the following datas into molecular structure:
(1)SMILES: [SrH2].O[C@@H]([C@H](O)[C@H](O)CO)[C@@H](O)C([O-])=O.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
(2)InChI: InChI=1/2C6H12O7.Sr.2H/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;;;/h2*2-5,7-11H,1H2,(H,12,13);;;/p-2/t2*2-,3-,4+,5-;;;/m11.../s1/r2C6H12O7.H2Sr/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);1H2/p-2/t2*2-,3-,4+,5-;/m11./s1
(3)InChIKey: BLAKRIPHNURJMH-AMUYYWKFBK