Products Categories
CAS No.: | 291-59-8 |
---|---|
Name: | Cyclohexasilane |
Molecular Structure: | |
Formula: | H12Si6 |
Molecular Weight: | 180.61 |
Synonyms: | Hexasilinane; |
PSA: | 0.00000 |
LogP: | -5.49720 |
The Cyclohexasilane has the CAS registry number 291-59-8. This chemical's molecular formula is H12Si6 and molecular weight is 180.61. What's more, its systematic name is hexasilinane.
You can still convert the following datas into molecular structure:
(1)SMILES: [SiH2]1[SiH2][SiH2][SiH2][SiH2][SiH2]1
(2)Std. InChI: InChI=1S/H12Si6/c1-2-4-6-5-3-1/h1-6H2
(3)Std. InChIKey: GCOJIFYUTTYXOF-UHFFFAOYSA-N