Products Categories
CAS No.: | 4295-55-0 |
---|---|
Name: | CLOFENAMIC ACID |
Article Data: | 7 |
Molecular Structure: | |
Formula: | C13H9Cl2NO2 |
Molecular Weight: | 282.126 |
Synonyms: | Anthranilicacid, N-(2,3-dichlorophenyl)- (6CI,7CI,8CI);2-(2,3-Dichloroanilino)benzoicacid;Clofenamic acid;N-(2,3-Dichlorophenyl)anthranilic acid; |
EINECS: | 224-301-3 |
Density: | 1.47 g/cm3 |
Melting Point: | 256-257 °C |
Boiling Point: | 407.1 °C at 760 mmHg |
Flash Point: | 200 °C |
Appearance: | yellowish crystalline powder |
PSA: | 49.33000 |
LogP: | 4.50820 |
The Benzoic acid,2-[(2,3-dichlorophenyl)amino]-, with the CAS registry number 4295-55-0, is also known as Acido clofenamico. Its EINECS registry number is 224-301-3. This chemical's molecular formula is C13H9Cl2NO2 and molecular weight is 281.001034. Its IUPAC name is called 2-(2,3-dichloroanilino)benzoic acid.
Physical properties of Benzoic acid,2-[(2,3-dichlorophenyl)amino]-: (1)ACD/LogP: 6.08; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 4.2; (4)ACD/LogD (pH 7.4): 3.01; (5)ACD/BCF (pH 5.5): 324.36; (6)ACD/BCF (pH 7.4): 21.17; (7)ACD/KOC (pH 5.5): 639.52; (8)ACD/KOC (pH 7.4): 41.74; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Index of Refraction: 1.677; (13)Molar Refractivity: 72.34 cm3; (14)Molar Volume: 191.9 cm3; (15)Surface Tension: 60.1 dyne/cm; (16)Density: 1.47 g/cm3; (17)Flash Point: 200 °C; (18)Enthalpy of Vaporization: 69.48 kJ/mol; (19)Boiling Point: 407.1 °C at 760 mmHg; (20)Vapour Pressure: 2.33E-07 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C(=C1)C(=O)O)NC2=C(C(=CC=C2)Cl)Cl
(2)InChI: InChI=1S/C13H9Cl2NO2/c14-9-5-3-7-11(12(9)15)16-10-6-2-1-4-8(10)13(17)18/h1-7,16H,(H,17,18)
(3)InChIKey: JONFYSWOLCTYFK-UHFFFAOYSA-N