Products Categories
| CAS No.: | 50543-23-2 |
|---|---|
| Name: | 2-FLUORO-6-HYDROXYPYRIDINE |
| Molecular Structure: | |
|
|
|
| Formula: | C5H4FNO |
| Molecular Weight: | 113.09 |
| Synonyms: | 2-Fluoro-6-hydroxypyridine;2-Hydroxy-6-fluoropyridine;6-Fluoro-2-hydroxypyridine;6-Fluoro-2-pyridinol; |
| Density: | 1.26 g/cm3 |
| Melting Point: | 125-129℃ |
| Boiling Point: | 273.1 °C at 760 mmHg |
| Flash Point: | 119 °C |
| Hazard Symbols: | Xn |
| Risk Codes: | 22 |
| PSA: | 33.12000 |
| LogP: | 0.92630 |
What can I do for you?
Get Best Price
The CAS register number of 2-Fluoro-6-hydroxypyridine is 50543-23-2. It also can be called as 2(1H)-Pyridinone,6-fluoro- and the systematic name about this chemical is 6-fluoropyridin-2(1H)-one. It belongs to the following product categories, such as Pyridine, Pyridines and so on.
Physical properties about 2-Fluoro-6-hydroxypyridine are: (1)ACD/LogP: -0.65; (2)ACD/LogD (pH 5.5): -0.66; (3)ACD/LogD (pH 7.4): -1.18; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 10.22; (7)ACD/KOC (pH 7.4): 3.13; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)Polar Surface Area: 20.31Å2; (11)Index of Refraction: 1.508; (12)Molar Refractivity: 26.62 cm3; (13)Molar Volume: 89.2 cm3; (14)Polarizability: 10.55x10-24cm3; (15)Surface Tension: 33.4 dyne/cm; (16)Enthalpy of Vaporization: 51.14 kJ/mol; (17)Boiling Point: 273.1 °C at 760 mmHg; (18)Vapour Pressure: 0.00585 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: F\C1=C\C=C/C(=O)N1
(2)InChI: InChI=1/C5H4FNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8)
(3)InChIKey: AJRUXHIEYSYRQJ-UHFFFAOYAT
(4)Std. InChI: InChI=1S/C5H4FNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8)
(5)Std. InChIKey: AJRUXHIEYSYRQJ-UHFFFAOYSA-N