Products Categories
CAS No.: | 5412-82-8 |
---|---|
Name: | 7-Amino-2-naphthalenesulfonic acid sodium salt |
Molecular Structure: | |
Formula: | C10H8NNaO3S |
Molecular Weight: | 245.23 |
Synonyms: | 2-Naphthalenesulfonic acid, 7-amino-, sodium salt (1:1); |
EINECS: | 226-498-1 |
Density: | 1.502g/cm3 |
Solubility: | Soluble in water |
Hazard Symbols: | Xi |
Risk Codes: | 36/38 |
Safety: | 26 |
PSA: | 91.60000 |
LogP: | 2.98810 |
What can I do for you?
Get Best Price
The 7-Amino-2-naphthalenesulfonic acid sodium salt, with the CAS registry number 5412-82-8, is also known as 2-Naphthalenesulfonic acid, 7-amino-, sodium salt (1:1). Its EINECS registry number is 226-498-1. This chemical's molecular formula is C10H8NNaO3S and molecular weight is 245.23. What's more, both its IUPAC name and systematic name are the same which is called Sodium 7-aminonaphthalene-2-sulfonate.
Physical properties about 7-Amino-2-naphthalenesulfonic acid sodium salt are: (1)#H bond acceptors: 4; (2)#H bond donors: 3; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 91.6 Å2.
You can still convert the following datas into molecular structure:
(1) SMILES: [Na+].[O-]S(=O)(=O)c1cc2cc(N)ccc2cc1
(2) InChI: InChI=1/C10H9NO3S.Na/c11-9-3-1-7-2-4-10(15(12,13)14)6-8(7)5-9;/h1-6H,11H2,(H,12,13,14);/q;+1/p-1
(3) InChIKey: BFGOSNKRBCAENG-REWHXWOFAX