Products Categories
| CAS No.: | 563-71-3 |
|---|---|
| Name: | ferrous carbonate |
| Molecular Structure: | |
|
|
|
| Formula: | FeCO3 |
| Molecular Weight: | 115.85 |
| Synonyms: | Ferronil;Ferrous monocarbonate;Iron carbonate (FeCO3);Iron(2+)carbonate;Iron(II) carbonate;Carbonic acid, iron(2+) salt (1:1); |
| EINECS: | 233-647-4 |
| Density: | 3.8 |
| Melting Point: | decomposes [CRC10] |
| Boiling Point: | 333.6 °C at 760 mmHg |
| Flash Point: | 169.8 °C |
| Solubility: | 0.0067g/100mL H2O (25°C) [CRC10] |
| Appearance: | White crystal |
| PSA: | 63.19000 |
| LogP: | -2.44950 |
The IUPAC name of ferrous carbonate is iron(2+) carbonate. With the CAS registry number 563-71-3, it is also named as Carbonic acid, iron(2+) salt (1:1). It belongs to the product's categories are Inorganics; Carbonate Mineral. Besides, ferrous carbonate composes siderite, which should be stored in a ventilated, dry storehouse. In addition, ferrous carbonate has molecular formula FeCO3 with molecular weight 115.85. What's more, its EINECS registry number is 209-259-6.
The other characteristics of ferrous carbonate can be summarized as: (1)EINECS: 209-259-6; (2)ACD/LogP: -0.81; (3)# of Rule of 5 Violations: 0; (4)ACD/LogD (pH 5.5): -1.98; (5)ACD/LogD (pH 7.4): -3.77; (6)ACD/BCF (pH 5.5): 1; (7)ACD/BCF (pH 7.4): 1; (8)ACD/KOC (pH 5.5): 1; (9)ACD/KOC (pH 7.4): 1; (10)#H bond acceptors: 3; (11)#H bond donors: 2; (12)#Freely Rotating Bonds: 0; (13)Polar Surface Area: 57.53 Å2; (14)Flash Point: 169.8 °C; (15)Enthalpy of Vaporization: 63.37 kJ/mol; (16)Boiling Point: 333.6 °C at 760 mmHg; (17)Vapour Pressure: 2.58E-05 mmHg at 25 °C.
People can use the following data to convert to the molecule structure of ferrous carbonate:
(1)SMILES: [Fe+2].[O-]C([O-])=O
(2)InChI: InChI=1/CH2O3.Fe/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2
(3)InChIKey: RAQDACVRFCEPDA-NUQVWONBAY