Products Categories
CAS No.: | 933721-75-6 |
---|---|
Name: | 1-Isoxazol-5-yl-ethylamine |
Molecular Structure: | |
Formula: | C5H8N2O |
Molecular Weight: | 112.13 |
Synonyms: | 1-ISOXAZOL-5-YL-ETHYLAMINE;1-(Isoxazol-5-yl)ethanaMine |
Density: | 1.091 g/cm3 |
Boiling Point: | 199.1 °C at 760 mmHg |
Flash Point: | 74.2 °C |
PSA: | 52.05000 |
LogP: | 1.39460 |
What can I do for you?
Get Best Price
The chemical with CAS registry number of 933721-75-6 is known as 1-Isoxazol-5-yl-ethylamine. The systematic name and product name are the same. The formula is C5H8N2O and the molecular weight is 112.13.
Physical properties about 1-Isoxazol-5-yl-ethylamine are: (1)#H bond acceptors: 3; (2)#H bond donors: 2; (3)#Freely Rotating Bonds: 2; (4)Polar Surface Area: 52.05Å2; (5)Index of Refraction: 1.49; (6)Molar Refractivity: 29.73 cm3; (7)Molar Volume: 102.6 cm3; (8)Polarizability: 11.78×10-24cm3; (9)Surface Tension: 40.8 dyne/cm; (10)Density: 1.091 g/cm3; (11)Flash Point: 74.2 °C; (12)Enthalpy of Vaporization: 43.53 kJ/mol; (13)Boiling Point: 199.1 °C at 760 mmHg; (14)Vapour Pressure: 0.348 mmHg at 25 °C.
You can still convert the following datas into molecular structure:
1. SMILES: CC(c1ccno1)N
2. InChI: InChI=1/C5H8N2O/c1-4(6)5-2-3-7-8-5/h2-4H,6H2,1H3
3. InChIKey: NEUUDZFNGAFNIO-UHFFFAOYAA
4. Std. InChI: InChI=1S/C5H8N2O/c1-4(6)5-2-3-7-8-5/h2-4H,6H2,1H3
5. Std. InChIKey: NEUUDZFNGAFNIO-UHFFFAOYSA-N