103039-88-9 Usage
Description
4-Methylisonipecotic acid ethyl ester, also known as ethyl 4-methylisonipecotate, is a chemical compound derived from the amino acid isonipecotic acid. It is characterized by its unique properties and versatile chemical structure, making it a valuable compound in the field of medicinal chemistry and drug development. This white crystalline powder is soluble in organic solvents such as ethanol and methanol, and has demonstrated potential in the treatment of neurological disorders as well as in the synthesis of various pharmaceuticals and organic compounds.
Uses
Used in Pharmaceutical Synthesis:
4-Methylisonipecotic acid ethyl ester is used as a building block in the pharmaceutical industry for the synthesis of various drugs. Its unique chemical properties and versatile structure make it an essential component in the development of new medications.
Used in Neurological Disorder Treatment:
In the medical field, 4-Methylisonipecotic acid ethyl ester is used as a potential treatment for neurological disorders. Its application in this area is due to its demonstrated potential to address specific conditions affecting the nervous system, offering new avenues for therapeutic intervention.
Used in Organic Compound Synthesis:
4-Methylisonipecotic acid ethyl ester is also utilized in the synthesis of organic compounds across various industries. Its solubility in organic solvents and reactivity make it a suitable candidate for creating a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 103039-88-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,3 and 9 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 103039-88:
(8*1)+(7*0)+(6*3)+(5*0)+(4*3)+(3*9)+(2*8)+(1*8)=89
89 % 10 = 9
So 103039-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H17NO2/c1-3-12-8(11)9(2)4-6-10-7-5-9/h10H,3-7H2,1-2H3
