106064-06-6 Usage
General Description
(Z)-3-(2-(2-(Dimethylamino)propoxy(and 1-methylethoxy))phenoxy)-4-phenyl-3-buten-2-one maleate is a complex chemical compound with a long, detailed name. (Z)-3-(2-(2-(Dimethylamino)propoxy(and 1-methylethoxy))phenoxy)-4-phen yl-3-buten-2-one maleate is a maleate salt of a specific chemical containing a dimethylamino group and a phenoxy group, among other functional groups. The exact properties and uses of this compound are not readily discernible from its name alone, but its complex structure suggests that it may have a wide range of potential applications in pharmaceuticals, materials science, or other fields where carefully designed molecules with specific properties are needed. Further analysis and research would be required to fully understand the implications and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 106064-06-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,6,0,6 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 106064-06:
(8*1)+(7*0)+(6*6)+(5*0)+(4*6)+(3*4)+(2*0)+(1*6)=86
86 % 10 = 6
So 106064-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H25NO3.C4H4O4/c1-17(23)21(16-18-10-5-4-6-11-18)25-20-13-8-7-12-19(20)24-15-9-14-22(2)3;5-3(6)1-2-4(7)8/h4-8,10-13,16H,9,14-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b21-16-;2-1-