107346-32-7 Usage
General Description
4-AMINO-8-BROMO-N-PROPYL-DAZINE-3-AMIDE is a chemical compound with the molecular formula C6H11BrN4O. It is a derivative of the dazine class of compounds, which are known for their potential pharmaceutical applications. This specific compound has a bromine atom at the 8th position of the dazine ring, an amino group at the 4th position, and a propyl group attached to the nitrogen atom. It is an amide, indicating the presence of a carbonyl group connected to a nitrogen atom. The compound's precise properties, uses, and potential biological activities are not explicitly stated, but it may have relevance in the field of medicinal chemistry. Further research and testing would be necessary to fully understand the potential applications of 4-AMINO-8-BROMO-N-PROPYL-DAZINE-3-AMIDE.
Check Digit Verification of cas no
The CAS Registry Mumber 107346-32-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,3,4 and 6 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 107346-32:
(8*1)+(7*0)+(6*7)+(5*3)+(4*4)+(3*6)+(2*3)+(1*2)=107
107 % 10 = 7
So 107346-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H13BrN4O/c1-2-6-15-12(18)11-9(14)7-4-3-5-8(13)10(7)16-17-11/h3-5H,2,6H2,1H3,(H2,14,16)(H,15,18)
