107888-00-6 Usage
General Description
The chemical compound (4E)-1-(4-bromophenyl)-4-[[2-[[(E)-[1-(4-bromophenyl)-4,5-dioxo-2-sulfanylidenepyrrolidin-3-ylidene]-phenylmethyl]amino]ethylamino]-phenylmethylidene]-5-sulfanylidenepyrrolidine-2,3-dione is a complex molecule containing multiple functional groups. It consists of a pyrrolidine-2,3-dione core with multiple phenyl and bromophenyl groups attached to it. Additionally, it contains sulfanylidenepyrrolidine groups and an aminoethylamino group. The molecule is a combination of a pyrrolidine-2,3-dione core with nitrogen-containing substituents, making it likely to have biological activity or potential for use in pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-00-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 107888-00:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*0)=146
146 % 10 = 6
So 107888-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C36H24Br2N4O4S2/c37-23-11-15-25(16-12-23)41-33(45)31(43)27(35(41)47)29(21-7-3-1-4-8-21)39-19-20-40-30(22-9-5-2-6-10-22)28-32(44)34(46)42(36(28)48)26-17-13-24(38)14-18-26/h1-18,39-40H,19-20H2/b29-27+,30-28+