107888-02-8 Usage
General Description
The chemical "(4E)-4-[[2-[[(E)-(4,5-dioxo-1-phenyl-2-sulfanylidene-pyrrolidin-3-ylid ene)-phenyl-methyl]amino]ethylamino]-phenyl-methylidene]-1-phenyl-5-su lfanylidene-pyrrolidine-2,3-dione" is a complex compound with multiple functional groups. It contains a sulfanylidene group, multiple phenyl groups, and pyrrolidine-dione rings. The compound is a derivative of pyrrolidine and contains both amine and amide functional groups. Based on its structure, it may have potential pharmaceutical or biological activity, but its specific properties and uses would need to be further investigated through experimentation and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 107888-02-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,8,8 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 107888-02:
(8*1)+(7*0)+(6*7)+(5*8)+(4*8)+(3*8)+(2*0)+(1*2)=148
148 % 10 = 8
So 107888-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C36H26N4O4S2/c41-31-27(35(45)39(33(31)43)25-17-9-3-10-18-25)29(23-13-5-1-6-14-23)37-21-22-38-30(24-15-7-2-8-16-24)28-32(42)34(44)40(36(28)46)26-19-11-4-12-20-26/h1-20,37-38H,21-22H2/b29-27+,30-28+