107914-05-6 Usage
Chemical compound
2-amino-5,8-dimethoxy-1,2,3,4-tetrahydro-1,4-epoxynaphthalene
Structure
Contains an amino group, two methoxy groups, and a tetrahydro and epoxide ring in its naphthalene backbone
Applications
Potential in pharmacology and organic synthesis
Functional groups
Amino group, methoxy groups, tetrahydro ring, and epoxide ring
Reactivity
Epoxide ring can undergo various reactions to form new compounds
Building block
Can serve as a valuable building block in the synthesis of complex molecules
Handling
Important to handle with care due to potential reactivity and toxicity
Check Digit Verification of cas no
The CAS Registry Mumber 107914-05-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,7,9,1 and 4 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 107914-05:
(8*1)+(7*0)+(6*7)+(5*9)+(4*1)+(3*4)+(2*0)+(1*5)=116
116 % 10 = 6
So 107914-05-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO3/c1-14-7-3-4-8(15-2)11-10(7)9-5-6(13)12(11)16-9/h3-4,6,9,12H,5,13H2,1-2H3
