108132-90-7 Usage
Description
2,4-Dihydro-4-ethyl-5-(3,4,5-trimethoxyphenyl)-3H-1,2,4-triazol-3-one is a complex chemical compound featuring a triazole ring fused with a phenyl group and adorned with multiple methoxy groups. It is a triazolone herbicide specifically designed for the control of weeds in agricultural settings.
Uses
Used in Agricultural Industry:
2,4-Dihydro-4-ethyl-5-(3,4,5-trimethoxyphenyl)-3H-1,2,4-triazol-3-one is used as a herbicidal agent for weed control in various crops. It operates by inhibiting the enzyme acetolactate synthase, which is crucial for the growth and development of target weeds, thereby disrupting their normal physiological processes.
This triazolone herbicide is valued for its effectiveness and selectivity, ensuring that it targets weeds without causing undue harm to non-target organisms. Additionally, it is recognized for its low toxicity and minimal environmental impact when applied according to the prescribed guidelines, making it a preferred choice for sustainable agricultural practices. However, it is imperative to adhere to proper handling and application protocols to guarantee both safety and the desired herbicidal effects.
Check Digit Verification of cas no
The CAS Registry Mumber 108132-90-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,1,3 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 108132-90:
(8*1)+(7*0)+(6*8)+(5*1)+(4*3)+(3*2)+(2*9)+(1*0)=97
97 % 10 = 7
So 108132-90-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H17N3O4/c1-5-16-12(14-15-13(16)17)8-6-9(18-2)11(20-4)10(7-8)19-3/h6-7H,5H2,1-4H3,(H,15,17)