108806-41-3 Usage
Description
YM 17690 is a chemical compound with potential biological activity in the field of pharmaceuticals. It is considered an experimental drug with the ability to interact with biological systems in a specific way. Although the exact structure and properties of YM 17690 are not readily available, it has been the focus of research and development in the pharmaceutical industry due to its potential therapeutic uses, particularly in the treatment of certain diseases or conditions. Further studies are needed to fully understand the mechanisms of action and potential applications of YM 17690 in the medical field.
Uses
Used in Pharmaceutical Industry:
YM 17690 is used as an experimental drug for its potential therapeutic uses in treating certain diseases or conditions. Its specific interactions with biological systems make it a promising candidate for further research and development.
YM 17690 is used as a research compound for understanding its mechanisms of action and exploring its potential applications in the medical field. Further studies are required to determine its efficacy, safety, and optimal use in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 108806-41-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,8,8,0 and 6 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 108806-41:
(8*1)+(7*0)+(6*8)+(5*8)+(4*0)+(3*6)+(2*4)+(1*1)=123
123 % 10 = 3
So 108806-41-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H29NO7/c30-26(31)16-10-21-9-15-25(36-19-27(32)33)24(18-21)29-28(34)22-11-13-23(14-12-22)35-17-5-4-8-20-6-2-1-3-7-20/h1-3,6-7,9,11-15,18H,4-5,8,10,16-17,19H2,(H,29,34)(H,30,31)(H,32,33)