109759-03-7 Usage
General Description
1-(2-aminoethylthio)-1-(2-chlorophenyl)nonan-3-one is a chemical compound that contains an aminoethylthio group and a chlorophenyl group attached to a nonan-3-one backbone. 1-(2-aminoethylthio)-1-(2-chlorophenyl)nonan-3-one may have potential applications in the fields of pharmaceuticals, agrochemicals, and materials science. Its chemical structure suggests that it may have a variety of properties and potential uses, but further research and investigation are needed to fully understand its potential benefits and risks.
Check Digit Verification of cas no
The CAS Registry Mumber 109759-03-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,7,5 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 109759-03:
(8*1)+(7*0)+(6*9)+(5*7)+(4*5)+(3*9)+(2*0)+(1*3)=147
147 % 10 = 7
So 109759-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H26ClNOS/c1-2-3-4-5-8-14(20)13-17(21-12-11-19)15-9-6-7-10-16(15)18/h6-7,9-10,17H,2-5,8,11-13,19H2,1H3