110967-13-0 Usage
General Description
2-AMINO-PYRIDO[3,2-D]PYRIMIDIN-4(1H)-ONE is a chemical compound comprised of a pyridopyrimidinone structure with an amino group attached to the pyridine ring. It is a heterocyclic compound that is commonly used in medicinal chemistry as a scaffold for the development of potential pharmaceutical agents. 2-AMINO-PYRIDO[3,2-D]PYRIMIDIN-4(1H)-ONE has been found to have potential biological activities, including anti-tumor and anti-inflammatory properties. Its unique structure and potential pharmacological properties make it a promising candidate for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 110967-13-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,0,9,6 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 110967-13:
(8*1)+(7*1)+(6*0)+(5*9)+(4*6)+(3*7)+(2*1)+(1*3)=110
110 % 10 = 0
So 110967-13-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O/c8-7-10-4-2-1-3-9-5(4)6(12)11-7/h1-3H,(H3,8,10,11,12)