111652-29-0 Usage
Specific content
Different sources of media describe the Specific content of 111652-29-0 differently. You can refer to the following data:
1. Ramoplanin
2. Belongs to a class of antibiotics derived from cyclic peptides
3. Effective against a wide range of Gram-positive bacteria, including antibiotic-resistant strains
4. Inhibits the process of cell wall synthesis in bacteria, leading to cell lysis and ultimately the death of the bacteria
5. Has been studied for its potential use in treating infections caused by bacteria such as methicillin-resistant Staphylococcus aureus (MRSA) and vancomycin-resistant enterococci (VRE)
6. Research suggests that Ramoplanin may have the ability to inhibit the formation of bacterial biofilms, which can be difficult to treat with conventional antibiotics
Classification
Cyclic peptide antibiotic
Target bacteria
Gram-positive bacteria
Mechanism of action
Interferes with bacterial cell wall synthesis
Potential use
Treating antibiotic-resistant bacterial infections
Inhibition of biofilm formation
Promising candidate for treating biofilm-related infections
Check Digit Verification of cas no
The CAS Registry Mumber 111652-29-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,1,6,5 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 111652-29:
(8*1)+(7*1)+(6*1)+(5*6)+(4*5)+(3*2)+(2*2)+(1*9)=90
90 % 10 = 0
So 111652-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H32N6O7/c1-7(19)13(25)20-8(2)14(26)21-9(3)15(27)22-10(4)16(28)23-11(5)17(29)24-12(6)18(30)31/h7-12H,19H2,1-6H3,(H,20,25)(H,21,26)(H,22,27)(H,23,28)(H,24,29)(H,30,31)/t7?,8?,9-,10?,11-,12?/m0/s1