112529-18-7 Usage
Chemical compound
A substance formed by the modification of the DNA base guanosine at its O(6) position, resulting in the addition of an ethano group.
Formation
Occurs due to exposure to various chemical agents or environmental carcinogens, leading to DNA damage.
Potential biomarker
Identified for exposure to harmful agents and is being studied as a marker for assessing DNA damage in cells.
Role in DNA adduct formation
Found to play a role in the formation of DNA adducts, which can contribute to mutagenesis and carcinogenesis.
Ongoing research
Being studied to further understand its potential impact on human health and its implications for the development of novel biomarkers and therapeutic interventions.
Structural modification
The addition of an ethano group to the O(6) position of guanosine alters the structure and function of the DNA molecule.
DNA damage
The formation of 1,O(6)-ethanoguanosine is associated with DNA damage, which can lead to mutations and potentially cancerous cells.
Environmental exposure
The modification of guanosine to form 1,O(6)-ethanoguanosine can occur due to exposure to environmental carcinogens, such as tobacco smoke or certain industrial chemicals.
Detection methods
Various analytical techniques, such as mass spectrometry or immunoassays, can be used to detect and quantify 1,O(6)-ethanoguanosine in biological samples.
Therapeutic implications
Understanding the role of 1,O(6)-ethanoguanosine in DNA damage and carcinogenesis may lead to the development of new therapeutic strategies for cancer prevention and treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 112529-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,2,5,2 and 9 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 112529-18:
(8*1)+(7*1)+(6*2)+(5*5)+(4*2)+(3*9)+(2*1)+(1*8)=97
97 % 10 = 7
So 112529-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N5O5/c13-12-15-9-6(10-16(12)1-2-21-10)14-4-17(9)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,13,18-20H,1-3H2/p+1/b13-12-/t5-,7-,8-,11?/m1/s1