118449-41-5 Usage
Description
1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole is a heterocyclic chemical compound with the molecular formula C18H17BrN2O. It features a pyrazole ring with bromine and phenyl substituents, along with a hydroxyethyl group attached to one of the nitrogen atoms. 1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole holds promise in the realms of organic synthesis and medicinal chemistry due to its structural and chemical properties, making it a versatile building block for the synthesis of other organic compounds and a potential pharmacophore for drug development. The bromine atom in its structure also lends itself to various organic transformations and as a precursor for further chemical reactions, expanding its utility in scientific and industrial applications.
Uses
Used in Organic Synthesis:
1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole is used as a building block for the synthesis of other organic compounds, leveraging its unique structure and reactivity to create a diverse range of molecules with potential applications in various industries.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole is used as a potential pharmacophore. Its structural features make it a candidate for the development of new drugs, particularly those targeting specific biological receptors or pathways.
Used in Chemical Reactions as a Precursor:
The bromine atom in 1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole makes it a useful precursor in certain organic transformations, allowing for the creation of new compounds through substitution or other reaction mechanisms.
Overall, 1-(2-hydroxyethyl)-3,5-diphenyl-4-bromo-1H-pyrazole's multifaceted utility in organic synthesis, medicinal chemistry, and as a precursor for chemical reactions positions it as a valuable compound for further research and development across different scientific and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 118449-41-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,8,4,4 and 9 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 118449-41:
(8*1)+(7*1)+(6*8)+(5*4)+(4*4)+(3*9)+(2*4)+(1*1)=135
135 % 10 = 5
So 118449-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H15BrN2O/c18-15-16(13-7-3-1-4-8-13)19-20(11-12-21)17(15)14-9-5-2-6-10-14/h1-10,21H,11-12H2
