121322-22-3 Usage
Chemical structure
1H-Pyrazole, 4,5-dihydro-5-(2-furanyl)-1-(3-pyridinylcarbonyl)is a complex organic compound that consists of a pyrazole ring, a furanyl group, and a pyridinylcarbonyl moiety.
Heterocyclic structure
The compound contains a pyrazole ring, which is a five-membered ring with one nitrogen atom and one non-nitrogen atom (heteroatoms) in the ring.
Furanyl group
The compound includes a furanyl group (a five-membered ring with one oxygen atom) that contributes to its potential bioactivity.
Pyridinylcarbonyl moiety
The presence of a pyridinylcarbonyl group (a six-membered ring with one nitrogen atom and a carbonyl group) adds to the compound's complexity and may contribute to its potential applications.
Laboratory research use
This compound is used as a building block for the synthesis of other organic compounds in laboratory research.
Potential applications
Due to its heterocyclic structure, 1H-Pyrazole, 4,5-dihydro-5-(2-furanyl)-1-(3-pyridinylcarbonyl)may have potential applications in the development of pharmaceuticals or agrochemicals.
Further research needed
More research is required to fully understand the properties and potential uses of this compound, as its complex structure and heterocyclic nature may contribute to bioactivity and various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 121322-22-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,3,2 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 121322-22:
(8*1)+(7*2)+(6*1)+(5*3)+(4*2)+(3*2)+(2*2)+(1*2)=63
63 % 10 = 3
So 121322-22-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3O2/c17-13(10-3-1-6-14-9-10)16-11(5-7-15-16)12-4-2-8-18-12/h1-4,6-9,11H,5H2
