122991-69-9 Usage
General Description
(3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is a chemical compound that is composed of a palladium atom bonded to a 3-methylorotato ligand and a 1,2-diaminocyclohexane ligand. It is classified as a coordination complex due to the presence of these ligands, which coordinate to the central palladium atom. Coordination complexes are widely used in various chemical reactions and catalysis. This specific compound has potential applications in organic synthesis, catalysis, and as a reagent in chemical reactions. Its structure and properties make it of interest for further study and potential practical applications in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 122991-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,9,9 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 122991-69:
(8*1)+(7*2)+(6*2)+(5*9)+(4*9)+(3*1)+(2*6)+(1*9)=139
139 % 10 = 9
So 122991-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O4.C6H14N2.Pd/c1-8-4(9)2-3(5(10)11)7-6(8)12;7-5-3-1-2-4-6(5)8;/h2H,1H3,(H,7,12)(H,10,11);5-6H,1-4,7-8H2;/q;;+2/p-2