123025-94-5 Usage
General Description
Preprovasoactive intestinal peptide (111-122) is a peptide hormone derived from the precursor protein, preprovasoactive intestinal peptide. This specific sequence of the peptide acts as a vasodilator, meaning it relaxes and widens blood vessels, leading to increased blood flow and reduced blood pressure. It also plays a role in regulating gastrointestinal function, immune responses, and the release of other hormones. Additionally, preprovasoactive intestinal peptide (111-122) has been studied for its potential therapeutic effects in conditions such as hypertension, asthma, and inflammatory bowel disease. Overall, this chemical plays a crucial role in modulating various physiological processes and has the potential to be used in the development of new treatments for several medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 123025-94-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,0,2 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 123025-94:
(8*1)+(7*2)+(6*3)+(5*0)+(4*2)+(3*5)+(2*9)+(1*4)=85
85 % 10 = 5
So 123025-94-5 is a valid CAS Registry Number.
InChI:InChI=1/C53H87N13O21/c1-9-26(8)41(64-43(76)28(18-35(54)70)57-45(78)30(20-67)59-46(79)31(21-68)60-49(82)38(55)23(2)3)50(83)61-32(22-69)44(77)56-27(14-15-36(71)72)42(75)58-29(19-37(73)74)51(84)65-16-10-12-33(65)47(80)62-39(24(4)5)52(85)66-17-11-13-34(66)48(81)63-40(25(6)7)53(86)87/h23-34,38-41,67-69H,9-22,55H2,1-8H3,(H2,54,70)(H,56,77)(H,57,78)(H,58,75)(H,59,79)(H,60,82)(H,61,83)(H,62,80)(H,63,81)(H,64,76)(H,71,72)(H,73,74)(H,86,87)/t26-,27-,28-,29-,30-,31-,32-,33-,34-,38-,39-,40-,41-/m0/s1