126533-97-9 Usage
Description
2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde is a heterocyclic chemical compound belonging to the class of thiazole derivatives. It features a thiazole ring fused with a morpholine and an aldehyde functional group, exhibiting potential pharmacological activities such as antimicrobial, antifungal, and antitumor properties. 2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde has garnered interest for its biological activities and its potential as a drug candidate, as well as its utility as a reagent in organic synthesis for the preparation of various heterocyclic compounds. Its distinctive structure and promising biological activities render it a significant compound in the realms of medicinal and organic chemistry research.
Uses
Used in Pharmaceutical Industry:
2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde is used as a drug candidate for its demonstrated antimicrobial, antifungal, and antitumor properties, making it a promising agent for the development of new therapeutics to combat various diseases and infections.
Used in Organic Synthesis:
In the field of organic chemistry, 2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde serves as a reagent for the synthesis of a variety of heterocyclic compounds, contributing to the advancement of chemical libraries and the discovery of novel chemical entities with potential applications in various industries.
Used in Medicinal Chemistry Research:
2-Morpholin-4-yl-1,3-thiazole-4-carboxaldehyde is utilized in medicinal chemistry for studying its biological activities and exploring its potential as a lead compound in drug discovery, focusing on its ability to target specific biological pathways and mechanisms related to diseases and disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 126533-97-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,5,3 and 3 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 126533-97:
(8*1)+(7*2)+(6*6)+(5*5)+(4*3)+(3*3)+(2*9)+(1*7)=129
129 % 10 = 9
So 126533-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2S/c11-5-7-6-13-8(9-7)10-1-3-12-4-2-10/h5-6H,1-4H2
Harmful:;
