129541-34-0 Usage
General Description
Methyl 2,3,4-tri-O-acetyl-beta-D-thiogalactopyranosiduronic acid methyl ester is a chemical compound with the molecular formula C14H20O10S. It is a methyl ester derivative of a thio-galactopyranosiduronic acid, which is a sulfur-containing sugar derivative. METHYL 2,3,4-TRI-O-ACETYL-BETA-D-THIOGALACTOPYRANOSIDURONIC ACID METHYL ESTER is commonly used in organic chemistry as a building block for the synthesis of various other chemical compounds. It may also have potential applications in pharmaceuticals and drug development due to its unique structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 129541-34-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,5,4 and 1 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 129541-34:
(8*1)+(7*2)+(6*9)+(5*5)+(4*4)+(3*1)+(2*3)+(1*4)=130
130 % 10 = 0
So 129541-34-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H20O9S/c1-6(15)20-9-10(21-7(2)16)12(22-8(3)17)14(24-5)23-11(9)13(18)19-4/h9-12,14H,1-5H3
