130808-14-9 Usage
General Description
(2,9-Dimethyl-1,10-phenanthroline)(thiophenolato)copper(I) is a coordination complex compound that consists of a copper atom bonded to a 2,9-dimethyl-1,10-phenanthroline ligand and a thiophenolato ligand. The copper(I) ion is coordinated to the two ligands, forming a stable complex. (2,9-Dimethyl-1,10-phenanthroline)(thiophenolato)copper(I) has potential applications in various fields, such as catalysis, photophysics, and materials science. The 2,9-dimethyl-1,10-phenanthroline ligand is known for its strong chelating ability, while the thiophenolato ligand provides sulfur coordination to the copper(I) center. The compound's structure and properties make it an interesting subject for further study in the field of coordination chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 130808-14-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,8,0 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 130808-14:
(8*1)+(7*3)+(6*0)+(5*8)+(4*0)+(3*8)+(2*1)+(1*4)=99
99 % 10 = 9
So 130808-14-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2.C6H6S.Cu/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;7-6-4-2-1-3-5-6;/h3-8H,1-2H3;1-5,7H;/q;;+1/p-1
