131417-67-9 Usage
General Description
Alpha-amino-2-(3-hydroxy-5-methyl-4-isoxazolyl)methyl-5-methyl-3-oxo-4-isoxazoline-4-propionic acid is a chemical compound with a complex structure. It contains an amino group, a hydroxyl group, and isoxazoline and isoxazolyl rings. The presence of multiple functional groups suggests that it may have biological activity or pharmaceutical potential. The compound's precise properties and potential applications would likely require further study and analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 131417-67-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,4,1 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 131417-67:
(8*1)+(7*3)+(6*1)+(5*4)+(4*1)+(3*7)+(2*6)+(1*7)=99
99 % 10 = 9
So 131417-67-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3O6/c1-5-8(10(16)14-20-5)4-15-11(17)7(6(2)21-15)3-9(13)12(18)19/h9H,3-4,13H2,1-2H3,(H,14,16)(H,18,19)