134645-25-3 Usage
General Description
Tryptophan tryptophylquinone (TTQ) is a post-translational modification of the amino acid tryptophan that occurs in certain enzymes, such as methylamine dehydrogenase and glycerol-3-phosphate dehydrogenase. TTQ is formed through a series of enzymatic reactions, including the oxidation and cyclization of two tryptophan residues. Once formed, TTQ serves as a redox-active prosthetic group that is essential for the catalytic activity of these enzymes. TTQ-containing enzymes play important roles in various biochemical pathways, including the oxidation of primary amines and alcohols. The unique chemistry and functionality of TTQ make it an interesting target for research in enzymology and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 134645-25-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,6,4 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 134645-25:
(8*1)+(7*3)+(6*4)+(5*6)+(4*4)+(3*5)+(2*2)+(1*5)=123
123 % 10 = 3
So 134645-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C22H20N4O6/c23-13(22(31)32)7-11-9-3-1-2-4-14(9)25-18(11)12-8-15(27)20(30)19-17(12)10(21(24)26-19)5-6-16(28)29/h1-4,8,13,25-26H,5-7,23-24H2,(H,28,29)(H,31,32)