13479-19-1 Usage
Chemical structure
A complex molecular structure consisting of a thioxanthene core with an aminoethylaminoethyl group and a hydroxymethyl substituent.
Potential drug candidate
It has diverse pharmacological activities, making it a potential candidate for drug development.
Pharmacological activities
The compound exhibits antipsychotic and anti-inflammatory properties.
Molecular arrangement
The unique molecular arrangement and functional groups contribute to its diverse pharmacological activities.
Synthetic intermediate
It serves as a valuable synthetic intermediate for the development of new pharmaceuticals and chemical derivatives.
Versatility
The compound is versatile in the field of medicinal chemistry and drug development due to its unique properties and potential applications.
Research and development
Further research and development are needed to fully understand the compound's potential and optimize its use in pharmaceutical applications.
Safety and efficacy
As with any potential drug candidate, safety and efficacy studies are crucial to determine the compound's suitability for clinical use.
Intellectual property
The compound's unique structure and potential applications may be protected by patents, which could impact its development and commercialization.
Regulatory approval
If the compound progresses through the drug development pipeline, it will need to undergo rigorous testing and obtain regulatory approval before being marketed as a pharmaceutical product.
Check Digit Verification of cas no
The CAS Registry Mumber 13479-19-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,4,7 and 9 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13479-19:
(7*1)+(6*3)+(5*4)+(4*7)+(3*9)+(2*1)+(1*9)=111
111 % 10 = 1
So 13479-19-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O2S/c1-2-19-9-10-20-14-8-7-12(11-21)18-16(14)17(22)13-5-3-4-6-15(13)23-18/h3-8,19-21H,2,9-11H2,1H3