134826-36-1 Usage
Molecular structure
The compound consists of an acridine derivative with a sulfur atom attached to a phenyl-ethanone group.
Acridine moiety
A polycyclic aromatic hydrocarbon with potential biological activities, including anti-tumor and anti-microbial properties.
Sulfur atom
Suggests potential reactivity and the ability to form covalent bonds with other molecules.
Phenyl-ethanone group
A common organic functional group found in various natural and synthetic compounds.
Potential applications
The compound may have potential applications in medicinal chemistry and materials science due to its unique structure and biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 134826-36-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,4,8,2 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 134826-36:
(8*1)+(7*3)+(6*4)+(5*8)+(4*2)+(3*6)+(2*3)+(1*6)=131
131 % 10 = 1
So 134826-36-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H17NOS/c1-15-11-12-20-18(13-15)22(17-9-5-6-10-19(17)23-20)25-14-21(24)16-7-3-2-4-8-16/h2-13H,14H2,1H3